PD318088
PD318088 is a non-ATP competitive allosteric MEK1/2 inhibitor, binds simultaneously with ATP in a region of the MEK1 active site that is adjacent to the ATP-binding site.
| Trivial name | N/A |
| Catalog Number | S1568 |
| Molecular Formula | C21H16N4O |
| CAS# | 391210-00-7 |
| Inchi | #N/A |
| Inchi Key | #N/A |
| SMILES | O=C1NCCC2=C1C=C([NH]2)C3=CC(=NC=C3)C4=CC5=CC=CC=C5N=C4 |
| Size | 50mg |
| Supplier Page | http://www.selleckchem.com/products/PD318088.html |
| Additional Information | https://file.selleck.cn/downloads/struct/PD318088-chemical-structure-S1568.gif |
