Z-Guggulsterone
Broad spectrum steroid receptor ligand Others|Nuclear Receptors
| Catalog Number | B7431-50 |
| Research Area | Others|Nuclear Receptors |
| Molecular Formula | C21H28O2 |
| CAS# | 39025-23-5 |
| Purity | 98% |
| SMILES | O=C1C[C@H]([C@@](/C1=C/C)(C)CC2)[C@@H](CC3)[C@@H]2[C@](CC4)(C)C3=CC4=O |
| Size | 50mg |
| Supplier Page | https://www.apexbt.com/search.php?catalog=B7431 |
