Emorfazone | MedChemExpress (MCE)
Emorfazone (Pentoil) is a non-steroidal anti-inflammatory drug with oral activity. Emorfazone can significantly inhibit the release of bradykinin-like substances and kininogen. Emorfazone has anti-inflammatory and analgesic activity[1].
| Trivial name | Emorfazone |
| Catalog Number | HY-126609 |
| Alternative Name(s) | Pentoil; Nandron |
| Research Area | Inflammation/Immunology |
| CAS# | 38957-41-4 |
| Purity | ≥98.0% |
| SMILES | O=C1C(OCC)=C(N2CCOCC2)C=NN1C |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/emorfazone.html |