Isovitexin
Isovitexin, a natural product isolated and purified from the seeds of Vitex trifolia L., exhibits a potential antioxidant activity, shows a strong antihyperglycemic action, and inhibits α-glucosidase in vivo.
| Trivial name | / |
| Catalog Number | CSN13968 |
| Alternative Name(s) | / |
| Research Area | / |
| Molecular Formula | C21H20O10 |
| CAS# | 38953-85-4 |
| Purity | ≥98% |
| SMILES | OC1=C(C2=O)C(OC(C3=CC=C(O)C=C3)=C2)=CC(O)=C1[C@@H]([C@@H]([C@@H](O)[C@@H]4O)O)O[C@@H]4CO |
| Size | 1mg |
| Supplier Page | https://www.csnpharm.com/products/isovitexin.html |