Chelerythrine Chloride
Chelerythrine Chloride is a potent, cell-permeable inhibitor of protein kinase C (IC50 = 660 nM) and competitive with respect to the phosphate acceptor and non-competitive with respect to ATP.
| Trivial name | / |
| Catalog Number | CSN10607 |
| Alternative Name(s) | / |
| Research Area | Immunology/Inflammation |
| Molecular Formula | C21H18ClNO4 |
| CAS# | 3895-92-9 |
| Purity | ≥99% |
| SMILES | C[N+]1=CC2=C(OC)C(OC)=CC=C2C3=C1C4=CC5=C(OCO5)C=C4C=C3.[Cl-] |
| Size | 100mg |
| Supplier Page | https://www.csnpharm.com/products/chelerythrine-chloride.html |
