N-Sulfo-glucosamine sodium salt
N-sulfo-d-glucosamine is a member of the class of compounds known as hexoses that is soluble (in water) and an extremely strong acidic compound. It locates in the cytoplasm within the cells.
| Trivial name | / |
| Catalog Number | CSN24960 |
| Alternative Name(s) | / |
| Research Area | / |
| Molecular Formula | C6H12NNaO8S |
| CAS# | 38899-05-7 |
| Purity | ≥95% |
| SMILES | O=S([O-])(N[C@H]([C@@H](O)[C@H](O)[C@H](O)CO)C=O)=O.[Na+] |
| Size | 100mg |
| Supplier Page | https://www.csnpharm.com/products/n-sulfo-glucosamine-sodium-salt.html |