Tridecafluorohexane-1-sulfonic acid potassium salt
Tridecafluorohexane-1-sulfonic acid potassium salt (PFHxS), also known as potassium perfluorohexanesulfonate, is a perfluorochemical (PFC) that belongs to the perfluoroalkyl sulfonates group. Its presence as a contaminant in the effluents of Taiwanese industrial wastewater treatment plant (IWWTP) and municipal wastewater treatment plants (MWWTPs) has been evaluated. It has been detected in the human serum samples by on-line solid-phase extraction (SPE) method coupled to high-performance liquid chromatography (HPLC)-tandem mass spectrometry (MS/MS).
| Catalog Number | CBB1112403 |
| Alternative Name(s) | Perfluorohexanesulfonic acid potassium salt; Potassium tridecafluoro-1-hexanesulfonate |
| Molecular Formula | C6F13KO3S |
| CAS# | 3871-99-6 |
| Purity | >98% |
| Inchi | 1S/C6HF13O3S.K/c7-1(8,3(11,12)5(15,16)17)2(9,10)4(13,14)6(18,19)23(20,21)22;/h(H,20,21,22);/q;+1/p-1 |
| Inchi Key | RSCGQEBKFSGWJT-UHFFFAOYSA-M |
| SMILES | [K+].[O-]S(=O)(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| Size | Inquiry |
| Supplier Page | https://www.amerigoscientific.com/tridecafluorohexane-1-sulfonic-acid-potassium-salt-item-112403.html |