Neodiosmin
Phytochemicals
| Trivial name | NULL |
| Catalog Number | CS-T-59214 |
| Alternative Name(s) | 7-{[(2S,3R,4S,5S,6R)-4,5-dihydroxy-6- (hydroxymethyl)-3-{[(2S,3R,4R,5R,6S)-3,4,5- trihydroxy-6-methyloxan-2-yl]oxy}oxan-2-yl]oxy}-5- hydroxy-2-(3-hydroxy-4-methoxyphenyl)-4H-chromen-4- one |
| Research Area | Neodiosmin is a flavone glycoside isolated from C. aurantium. Neodiosmin along with other citrus flavonoids showed antiproliferative activities against several tumor and normal human cell lines. |
| Molecular Formula | C28H32O15 |
| CAS# | 38665-01-09 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | O=C(C=C(C1=CC(O)=C(OC)C=C1)OC2=CC(O[C@H](O[C@H](CO)[C@@H](O)[C@@H]3O)[C@@H]3O[C@@](O[C@@H](C)[C@H](O)[C@H]4O)([H])[C@@H]4O)=C5)C2=C5O |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CST59214.html |
| Additional Information | NULL |