(-)-N6-Phenylisopropyl adenosine | MedChemExpress (MCE)
(-)-N6-phenylisopropyl adenosine (D-phenylisopropyladenosine) is a adenosine receptor agonist. (-)-N6-phenylisopropyl adenosine inhibits K+-evoked Ca2+ uptake with an IC50 value of 0.5 µM[1].
| Trivial name | (-)-N6-Phenylisopropyl adenosine |
| Catalog Number | HY-136661 |
| Alternative Name(s) | L-Phenylisopropyladenosine; L-PIA |
| Research Area | Neurological Disease |
| CAS# | 38594-96-6 |
| Purity | ≥98.00% |
| SMILES | OC[C@@H]1[C@@H](O)[C@@H](O)[C@H](N2C3=NC=NC(N[C@H](C)CC4=CC=CC=C4)=C3N=C2)O1 |
| PubChem Chemical Structure ID | 168432113 |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/minus-n6-phenylisopropyl-adenosine.html |