Dinoprost Tromethamine
Dinoprost Tromethamine is a synthetic analogue of the naturally occurring prostaglandin F2 alpha. Prostaglandin F2 alpha stimulates myometrial activity, relaxes the cervix, inhibits corpus luteal steroidogenesis, and induces luteolysis by direct action on the corpus luteum.
| Catalog Number | API38562015 |
| Alternative Name(s) | Dinolytic Dinoprost trometamol Zinoprost |
| Research Area | Active Pharmaceutical Ingredients |
| Molecular Formula | C24H45NO8 |
| CAS# | 38562-01-5 |
| SMILES | CCCCCC(C=CC1C(CC(C1CC=CCCCC(=O)O)O)O)O.C(C(CO)(CO)N)O |
| Size | inquiry |
| Supplier Page | https://www.protheragen-ing.com/dinoprost-tromethamine-item-11977.html |