Taurohyodeoxycholic acid sodium
Taurohyodeoxycholic acid (THDCA) sodium is the taurine-conjugated form of the secondary bile acid hyodeoxycholic acid. Taurohyodeoxycholic acid can also reduce the activity and expression of myeloperoxidase TNF-α and IL-6, as well as colonic damage in TNBS-induced ulcerative colitis mouse model.
| Catalog Number | E7250 |
| Molecular Formula | C15H17FN4O3 |
| CAS# | 38411-85-7 |
| Inchi | InChI=1S/C15H17FN4O3/c1-2-19-8-10(15(22)23)12(21)9-7-11(16)14(18-13(9)19)20-5-3-17-4-6-20/h7-8,17H,2-6H2,1H3,(H,22,23) |
| Inchi Key | IDYZIJYBMGIQMJ-UHFFFAOYSA-N |
| SMILES | CCN1C=C(C(=O)C2=CC(=C(N=C21)N3CCNCC3)F)C(=O)O |
| Size | 50mg |
| Supplier Page | http://www.selleckchem.com/products/taurohyodeoxycholic-acid-sodium.html |
| Additional Information | https://file.selleck.cn/downloads/struct/e7250-taurohyodeoxycholic-acid-sodium-chemical-structure-tube.png |
