Bimatoprost acid
Bimatoprost acid is a metabolically stable analog of PGF2α and has a potential antagonistic activity for the FP receptor. It has a relative potency of 756% compared to PGF2α for binding to the FP receptor on ovine luteal cells.
| Catalog Number | T20939 |
| Alternative Name(s) | 17-phenyl trinor PGF2α , 17-phenyl trinor Prostaglandin F2α |
| Research Area | Endocrinology/Hormones|||GPCR/G Protein |
| Molecular Formula | C23H32O5 |
| CAS# | 38344-08-0 |
| Purity | 97.24% |
| SMILES | O[C@@H]1[C@H](C/C=C\CCCC(O)=O)[C@@H](/C=C/[C@@H](O)CCC2=CC=CC=C2)[C@H](O)C1 |
| Size | 1 mL |
| Supplier Page | https://www.targetmol.com/compound/Bimatoprost acid |
| Additional Information | https://www.targetmol.com/datasheet/T20939 |