Tenofovir alafenamide D5
Stable Isotopes
| Trivial name | NULL |
| Catalog Number | CS-O-15682 |
| Alternative Name(s) | GS 7171-d5; 1-Methylethyl Ester N-[[[(1R)-2-(6-Amino-9H-purin-9-yl)-1-methylethoxy]methyl]phenoxyphosphinyl]-L-alanine-d5 ; |
| Research Area | Labeled Tenofovir , intended for use as an internal standard for the quantification of Tenofovir by GC- or LC-mass spectrometry. |
| Molecular Formula | C21H24D5N6O5P |
| CAS# | 379270-36-7 (Unlabeled) |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | C[C@@H](OC[P](OC1=C([2H])C([2H])=C([2H])C([2H])=C1[2H])(N[C@@H](C)C(OC(C)C)=O)=O)CN2C3=NC=NC(N)=C3N=C2 |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO15682.html |
| Additional Information | NULL |