11-Deoxy prostaglandin E1 | MedChemExpress (MCE)
11-Deoxy prostaglandin E1 (AY-23578; Doproston B) is an analog of prostaglandin E1 (PGE1) with bronchodilator activity. 11-Deoxy prostaglandin E1 inhibits histamine-induced bronchoconstriction and causes relaxation of tracheal strips in isolated guinea pigs[1].
| Trivial name | 11-Deoxy prostaglandin E1 |
| Catalog Number | HY-128043 |
| Alternative Name(s) | AY-23578; Doproston B; 11-Deoxy-PGE1 |
| Research Area | Inflammation/Immunology |
| CAS# | 37786-00-8 |
| Purity | ≥98.0% |
| SMILES | OC(CCCCCC[C@@H]1[C@H](CCC1=O)/C=C/[C@@H](O)CCCCC)=O |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/11-deoxy-prostaglandin-e1.html |