11-deoxy Prostaglandin F1α | MedChemExpress (MCE)
11-deoxy Prostaglandin F1α (11-deoxy PGF1α) is an analog of prostaglandin F1α, exhibits side effects on intestines and causes the uterine contraction. 11-deoxy Prostaglandin F1α exhibits activity as vasopressor and bronchoconstrictor[1][2].
| Trivial name | 11-deoxy Prostaglandin F1α |
| Catalog Number | HY-131696 |
| Alternative Name(s) | 11-deoxy PGF1α |
| Research Area | Cardiovascular Disease; Others |
| CAS# | 37785-98-1 |
| Purity | ≥98.0% |
| SMILES | OC(CCCCCC[C@@H]1[C@H](CC[C@@H]1O)/C=C/[C@@H](O)CCCCC)=O |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/11-deoxy-prostaglandin-f1α.html |