BVT 2733
11beta-hydroxysteroid dehydrogenase type 1 (11β-HSD1) inhibitor Metabolism|Dehydrogenase
| Catalog Number | B6104-10 |
| Research Area | Metabolism|Dehydrogenase |
| Molecular Formula | C17H21ClN4O3S2 |
| CAS# | 376640-41-4 |
| Purity | 99.82% |
| SMILES | CC1=C(Cl)C=CC=C1S(NC2=NC(CC(N3CCN(CC3)C)=O)=CS2)(=O)=O |
| Size | 10mg |
| Supplier Page | https://www.apexbt.com/search.php?catalog=B6104 |
