Aprindine | MedChemExpress (MCE)
Aprindine is an arrhythmia inhibitor that stabilizes the cell membranes of heart muscle cells, thereby preventing abnormal electrical impulses from causing irregular heartbeats. In hematological toxicity studies, aprindine showed potential inhibitory effects on the replicative capacity of mouse and human blood cells at certain concentrations[1].
Trivial name | Aprindine |
Catalog Number | HY-A0236 |
Research Area | Cardiovascular Disease |
CAS# | 37640-71-4 |
Purity | ≥98.0% |
SMILES | CCN(CC)CCCN(C1CC2=C(C=CC=C2)C1)C3=CC=CC=C3 |
Size | 1 mg |
Supplier Page | https://www.medchemexpress.com/aprindine.html |