Biotin-PE-maleimide | MedChemExpress (MCE)
Biotin-PE-maleimide (N-Biotinyl-N’-[2-(N-maleimido)ethyl]piperazine) is a bulky, membrane-impermeable, sulfhydryl-containing reagent with a relatively large molecular size. Biotin-PE-maleimide can be used for biotin labeling (such as thiol groups) and detection of proteins or other biomolecules[1].
| Trivial name | Biotin-PE-maleimide |
| Catalog Number | HY-157920 |
| Alternative Name(s) | N-Biotinyl-N'-[2-(N-maleimido)ethyl]piperazine |
| Research Area | Others |
| CAS# | 374592-99-1 |
| Purity | ≥98.0% |
| SMILES | O=C(N1CCN(CC1)CCN2C(C=CC2=O)=O)CCCC[C@H]3[C@]4([H])[C@](NC(N4)=O)([H])CS3 |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/biotin-pe-maleimide.html |