3-Phenoxybenzoic acid
3-phenoxybenzoic acid (3-PBA), an intermediate metabolite of pyrethroids, is more toxic than its parent compounds and has been detected in milk, soil, and human urine.
| Trivial name | 3-PBA, m-phenoxybenzoic acid |
| Catalog Number | S3597 |
| Molecular Formula | C13H10O3 |
| CAS# | 3739-38-6 |
| Inchi | #N/A |
| Inchi Key | #N/A |
| SMILES | OC(=O)C1=CC(=CC=C1)OC2=CC=CC=C2 |
| Size | 100mg |
| Supplier Page | http://www.selleckchem.com/products/3-phenoxybenzoic-acid.html |
| Additional Information | https://file.selleck.cn/downloads/struct/s3597-3-phenoxybenzoic-acid-chemical-structure.gif |