Denatonium benzoate
Denatonium, a quaternary ammonium cation, is a compound of a salt with an inert anion like saccharide or benzoate. Its structure is involved in the local anesthetic lidocaine which difference only is the addition of a benzyl group to the amino nitrogen.
| Catalog Number | T1098 |
| Alternative Name(s) | THS-839 |
| Research Area | Others |
| Molecular Formula | C28H34N2O3 |
| CAS# | 3734-33-6 |
| Purity | 99.79% |
| SMILES | c1cccc(c1)C(=O)[O-].[N+](CC(=O)Nc1c(cccc1C)C)(CC)(CC)Cc1ccccc1 |
| Size | 200 mg |
| Supplier Page | https://www.targetmol.com/compound/Denatonium benzoate |
| Additional Information | https://www.targetmol.com/datasheet/T1098 |
