ZAPA sulfate | MedChemExpress (MCE)
ZAPA sulfate is an agonist at low affinity GABAA-receptors. ZAPA sulfate induces membrane hyperpolarization of the Ascaris muscle cell with an EC50 of 10.3 μM[1][2].
| Trivial name | ZAPA sulfate |
| Catalog Number | HY-100799 |
| Research Area | Neurological Disease |
| CAS# | 371962-01-5 |
| Purity | 99.25% |
| SMILES | O=C(O)/C=C\SC(N)=N.O=S(O)(O)=O |
| PubChem Chemical Structure ID | 90479730 |
| Size | 10 mg |
| Supplier Page | https://www.medchemexpress.com/zapa-sulfate.html |