PI3K-IN-18 | MedChemExpress (MCE)
PI3K-IN-18 (Compound 1) is a PI3K inhibitor, and can also effectively inhibit the homologous enzymemTOR. The IC50 values of PI3K-IN-18 for mTOR and PI3K-α were 49 nM and 41 nM, respectively[1].
| Trivial name | PI3K-IN-18 |
| Catalog Number | HY-109633 |
| Research Area | Cancer |
| CAS# | 371943-05-4 |
| Purity | ≥98.0% |
| SMILES | OC1=CC(C2=NC3=C(C(N4CCOCC4)=N2)SC=C3)=CC=C1 |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/pi3k-in-18.html |