PI-103 10mM * 1mL in DMSO
PI-103 is a potent, cell-permeable, ATP-competitive inhibitor of phosphatidylinositol 3-kinase (PI3K) family members with selectivity toward DNA-PK, PI3K (p110??), and mTOR.
| Trivial name | PI-103 10mM * 1mL in DMSO |
| Catalog Number | A10726-10mM-D |
| Alternative Name(s) | 3-[4-(4-Morpholinylpyrido[3',2':4,5]furo[3,2-d]pyrimidin-2-yl]phenol |
| Molecular Formula | C19H16N4O3 |
| CAS# | 371935-74-9 |
| SMILES | C1COCCN1C2=NC(=NC3=C2OC4=C3C=CC=N4)C5=CC(=CC=C5)O |
| Size | 10mM * 1mL in DMSO |
| Supplier Page | http://www.adooq.com/pi-103.html |
