Murrangatin
Murrangatin, a natural anti-tumor-promoting agent isolated and purified from the herbs of Murraya exotica L., exhibits cytotoxicity against cholangiocarcinoma cell line and significantly inhibits EBV-EA activation, and preserves the high viability of Raji cells.
| Trivial name | / |
| Catalog Number | CSN14208 |
| Alternative Name(s) | / |
| Research Area | Cancer |
| Molecular Formula | C15H16O5 |
| CAS# | 37126-91-3 |
| Purity | ≥98% |
| SMILES | O=C1C=CC2=CC=C(OC)C([C@@H](O)[C@@H](O)C(C)=C)=C2O1 |
| Size | 5mg |
| Supplier Page | https://www.csnpharm.com/products/murrangatin.html |