FCCP
FCCP, a potent uncoupler of oxidative phosphorylation in mitochondria, transport protons across cell membranes leading to disrupts ATP synthesis.
| Catalog Number | T6834 |
| Alternative Name(s) | Carbonyl cyanide 4-(trifluoromethoxy)phenylhydrazone , Trifluoromethoxy carbonylcyanide phenylhydrazone |
| Research Area | Metabolism|||Membrane transporter/Ion channel |
| Molecular Formula | C10H5F3N4O |
| CAS# | 370-86-5 |
| Purity | 99.50% |
| SMILES | FC(F)(F)Oc1ccc(N\N=C(\C#N)C#N)cc1 |
| Size | 200 mg |
| Supplier Page | https://www.targetmol.com/compound/FCCP |
| Additional Information | https://www.targetmol.com/datasheet/T6834 |