NSC 80538
NSC 80538 is a chemical compound that has been studied for its potential applications in scientific research. NSC 80538 is a member of the thiourea family.
| Catalog Number | T4178 |
| Research Area | Others |
| Molecular Formula | C13H10ClFN2S |
| CAS# | 370-26-3 |
| Purity | 99.50% |
| SMILES | c1cc(ccc1NC(=S)Nc1ccc(cc1)Cl)F |
| Size | 2 mg |
| Supplier Page | https://www.targetmol.com/compound/NSC 80538 |
| Additional Information | https://www.targetmol.com/datasheet/T4178 |