Zebularine
Zebularine is a DNA methylation inhibitor which forms a covalent complex with DNA methyltransferases, it also inhibits cytidinedeaminase with Ki of 2 μM.
| Trivial name | NSC 309132; 4-Deoxyuridine |
| Catalog Number | CSN12234 |
| Alternative Name(s) | NSC 309132; 4-Deoxyuridine |
| Research Area | Cancer|Cardiovascular Disease |
| Molecular Formula | C9H12N2O5 |
| CAS# | 3690-10-6 |
| Purity | ≥99% |
| SMILES | O=C1N=CC=CN1[C@H](O[C@@H]2CO)[C@H](O)[C@@H]2O |
| Size | 10mg |
| Supplier Page | https://www.csnpharm.com/products/zebularine.html |