4-Methylbenzylidene camphor
ultraviolet light blocker used in cosmetics and sunscreen preparations that also has estrogenic activities. Endocrinology and Hormones|Estrogen/progestogen Receptor
| Catalog Number | C3558-5.1 |
| Alternative Name(s) | Enzacamene|Eusolex 6300|4-MBC|Neo Heliopan MBC|Parsol 500|Uvinul MBC 95 |
| Research Area | Endocrinology and Hormones|Estrogen/progestogen Receptor |
| Molecular Formula | C18H22O |
| CAS# | 36861-47-9 |
| Purity | 99.73% |
| SMILES | CC1=CC=C(/C=C2[C@H]3CC[C@@](C)(C3(C)C)C/2=O)C=C1 |
| Size | 10mM (in 1mL DMSO) |
| Supplier Page | https://www.apexbt.com/search.php?catalog=C3558 |