Meclofenoxate HCl 10mM * 1mL in DMSO
Meclofenoxate HCl is an anti-aging drug used to treat the symptoms of senile dementia and Alzheimer’s disease, and also inhibits the activity of cholinephosphotransferase.
| Trivial name | Meclofenoxate HCl 10mM * 1mL in DMSO |
| Catalog Number | A14265-10mM-D |
| Alternative Name(s) | 2-(4-chlorophenoxy)-2-(dimethylamino)ethyl ester acetic acid, hydrochloride (1:1) |
| Molecular Formula | C12H17Cl2NO3 |
| CAS# | 3685-84-5 |
| SMILES | CN(C)CCOC(=O)COC1=CC=C(C=C1)Cl.Cl |
| Size | 10mM * 1mL in DMSO |
| Supplier Page | http://www.adooq.com/meclofenoxate-hcl.html |
