(±)-Silybin | MedChemExpress (MCE)
(±)-Silybin is the racemate of Silybin (HY-N0779A). Silybin induces apoptosis and exhibits hepatoprotective, antioxidant, anti-inflammatory, anti-cancer activity[1][2].
| Trivial name | (±)-Silybin |
| Catalog Number | HY-139637 |
| Alternative Name(s) | Silibinin (mixture of Silybin A and Silybin B) |
| Research Area | Cancer |
| CAS# | 36804-17-8 |
| Purity | 99.23% |
| SMILES | OC[C@@H]1[C@@H](C2=CC(OC)=C(C=C2)O)OC3=CC([C@H]4OC5=CC(O)=CC(O)=C5C([C@@H]4O)=O)=CC=C3O1 |
| PubChem Chemical Structure ID | 31553 |
| Size | 250 mg |
| Supplier Page | https://www.medchemexpress.com/racemic-silybin.html |