D-Glucose 6-phosphate disodium salt
D-Glucose 6-phosphate disodium salt is the disodium salt form of D-Glucose 6-phosphate, a common form of glucose within the cell, participating in two major metabolic pathways: glycolysis and the pentose phosphate pathway. It can be coverted to glycogen or starch for storage.
| Trivial name | N/A |
| Catalog Number | S5518 |
| Molecular Formula | C11H10BrN5 |
| CAS# | 3671-99-6 |
| Inchi | InChI=1S/C11H10BrN5/c12-9-7(17-11-15-5-6-16-11)1-2-8-10(9)14-4-3-13-8/h1-4H,5-6H2,(H2,15,16,17) |
| Inchi Key | XYLJNLCSTIOKRM-UHFFFAOYSA-N |
| SMILES | C1CN=C(N1)NC2=C(C3=NC=CN=C3C=C2)Br |
| Size | 25mg |
| Supplier Page | http://www.selleckchem.com/products/d-glucose-6-phosphate-disodium-salt.html |
| Additional Information | https://file.selleck.cn/downloads/struct/d-glucose-6-phosphate-disodium-salt-chemical-structure-s5518.gif |
