L-Carnitine tartrate
Amino Acids and Derivatives
| Trivial name | NULL |
| Catalog Number | CS-O-10983 |
| Alternative Name(s) | (R)-3-carboxy-2-hydroxy-N,N,N-trimethylpropan-1-aminium (2R,3R)-2,3-dihydroxysuccinate |
| Research Area | The tartrate salt of L-Carnitine |
| Molecular Formula | C18H36N2O12 |
| CAS# | 36687-82-8 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | O[C@@H](C([O-])=O)[C@@H](O)C([O-])=O.C[N+](C)(C)C[C@H](O)CC(O)=O.C[N+](C)(C)C[C@H](O)CC(O)=O |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO10983.html |
| Additional Information | NULL |