α-Zearalenol (Standard) | MedChemExpress (MCE)
α-Zearalenol (Standard) is the analytical standard of α-Zearalenol. This product is intended for research and analytical applications. α-Zearalenol is a Mycotoxin with high affinity for the estrogen receptors (ER), α-Zearalenol is the derivative of zearalenone (ZEN), causes reproductive disorders in animals, due to its xenoestrogenic effects[1].
| Trivial name | α-Zearalenol (Standard) |
| Catalog Number | HY-N6710R |
| Research Area | Inflammation/Immunology |
| CAS# | 36455-72-8 |
| Purity | ≥98.00% |
| SMILES | OC1=C2C(O[C@H](CCC[C@@H](CCC/C=C/C2=CC(O)=C1)O)C)=O |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/α-zearalenol-standard.html |