Diazoxide
Diazoxide is an ATP-sensitive potassium channel activator which causes local relaxation in smooth muscle by increasing membrane permeability to potassium ions. and can be used to treat hyperinsulinism.
| Trivial name | SCH 6783; SRG 95213 |
| Catalog Number | CSN12647 |
| Alternative Name(s) | SCH 6783; SRG 95213 |
| Research Area | Cardiovascular Disease |
| Molecular Formula | C8H7ClN2O2S |
| CAS# | 364-98-7 |
| Purity | ≥99% |
| SMILES | CC(NC1=CC=C(Cl)C=C12)=NS2(=O)=O |
| Size | 100mg |
| Supplier Page | https://www.csnpharm.com/products/diazoxide.html |