Cyclo(L-Ala-L-Pro)
Cyclo(L-Ala-L-Pro) is a natural product isolated and purified from Phellinus igniarius inhibiting aflatoxin production of Aspergillus parasiticus and Aspergillus flavus in liquid medium at concentrations of several hundred uM without affecting fungal growth.
| Trivial name | / |
| Catalog Number | CSN14562 |
| Alternative Name(s) | / |
| Research Area | / |
| Molecular Formula | C8H12N2O2 |
| CAS# | 36357-32-1 |
| Purity | ≥98% |
| SMILES | O=C(N[C@H]1C)[C@@](CCC2)([H])N2C1=O |
| Size | 5mg |
| Supplier Page | https://www.csnpharm.com/products/cyclo(l-ala-l-pro).html |