Fenbufen
COX inhibitor, non-steroidal anti-inflammatory drug Neuroscience|COX
| Catalog Number | B6127-5.1 |
| Research Area | Neuroscience|COX |
| Molecular Formula | C16H14O3 |
| CAS# | 36330-85-5 |
| Purity | 98% |
| SMILES | O=C(C1=CC=C(C2=CC=CC=C2)C=C1)CCC(O)=O |
| Size | 10mM (in 1mL DMSO) |
| Supplier Page | https://www.apexbt.com/search.php?catalog=B6127 |
