Piroxicam (Feldene) 10mM * 1mL in DMSO
Piroxicam is an effective and potent inhibitor of prostaglandin synthesis and a Cox-1 and Cox-2 inhibitor.
| Trivial name | Piroxicam (Feldene) 10mM * 1mL in DMSO |
| Catalog Number | A10736-10mM-D |
| Alternative Name(s) | 4-Hydroxy-2-methyl-N-2-pyridinyl-2H-1,2-benzothiazine-3-carboxamide 1,1-dioxide |
| Molecular Formula | C15H13N3O4S |
| CAS# | 36322-90-4 |
| SMILES | CN1C(=C(C2=CC=CC=C2S1(=O)=O)O)C(=O)NC3=CC=CC=N3 |
| Size | 10mM * 1mL in DMSO |
| Supplier Page | http://www.adooq.com/piroxicam-feldene.html |
