Jatrorrhizine
Jatrorrhizine is a protoberberine alkaloid isolated from some plant species like Enantia chlorantha. It can inhibit MAO-A and MAO-B noncompetitively with IC50 value of 4μM and 62μM, respectively. Also, it has antiinflammatory, antimicrobial and antifungal activity.
| Trivial name | neprotin; Yatrorizine |
| Catalog Number | CSN18732 |
| Alternative Name(s) | neprotin; Yatrorizine |
| Research Area | / |
| Molecular Formula | C20H20NO4 |
| CAS# | 3621-38-3 |
| Purity | ≥99% |
| SMILES | COC1=C(OC)C2=C[N+]3=C(C4=CC(OC)=C(O)C=C4CC3)C=C2C=C1 |
| Size | 5mg |
| Supplier Page | https://www.csnpharm.com/products/jatrorrhizine.html |