2-Methoxyestradiol 100mg
2-Methoxyestradiol is an apoptotic, antiproliferative and antiangiogenic agent. Induces p53-induced apoptosis via two pathways: activation of p38 and NF-??B; and activation of JNK and AP-1 leading to Bcl-2 phosphorylation.
Trivial name | 2-Methoxyestradiol 100mg |
Catalog Number | A10012-100 |
Alternative Name(s) | (17??)-2-Methoxyestra-1,3,5(10)-trien e-3,17-diol |
Molecular Formula | C19H26O3 |
CAS# | 362-07-2 |
SMILES | [H][C@@]12CC[C@H](O)[C@@]1(C)CC[C@]1([H])C3=C(CC[C@@]21[H])C=C(O)C(OC)=C3 |
Size | 100mg |
Supplier Page | http://www.adooq.com/2-methoxyestradiol.html |