Amphotericin B Methyl Ester
Intermediates
| Trivial name | NULL |
| Catalog Number | CS-T-48168 |
| Alternative Name(s) | Amphot Ester; |
| Research Area | Amphotericin B Methyl Ester is the methyl ester derivative of the polyene antibiotic Amphotericin B . Amphotericin B Methyl Esterin is a cholesterol binding compound that showed inhibiton of human immunodeficiency virus type 1 (HIV-1). |
| Molecular Formula | C48H75NO17 |
| CAS# | 36148-89-7 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | O=C([C@H]1[C@@](C[C@H](/C=C/C=C/C=C/C=C/C=C/C=C/C=C/[C@H](C)[C@@H](O)[C@@H](C)[C@H](C)OC2=O)O[C@@](O[C@H](C)[C@@H](O)[C@@H]3N)([H])[C@H]3O)([H])O[C@](O)(C[C@H](C[C@H]([C@@H](CC[C@H](C[C@H](C2)O)O)O)O)O)C[C@@H]1O)OC |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CST48168.html |
| Additional Information | NULL |