RBC8
RBC8 is a specific GTPases RalA/RalB inhibitor by inhibiting the binding of Ral to its effector RALBP1, no inhibition on the GTPases RhoA and Ras.
| Catalog Number | T6634 |
| Research Area | GPCR/G Protein|||MAPK |
| Molecular Formula | C25H20N4O3 |
| CAS# | 361185-42-4 |
| Purity | 99.81% |
| SMILES | COc1ccc(c(c1)C1C(=C(N)Oc2c1c(c1ccc3ccccc3c1)[nH]n2)C#N)OC |
| Size | 10 mg |
| Supplier Page | https://www.targetmol.com/compound/RBC8 |
| Additional Information | https://www.targetmol.com/datasheet/T6634 |