Cytidine 5′-triphosphate (disodium salt)
Cytidine 5′-triphosphate is a pyrimidine nucleoside triphosphate that is involved in a variety of biochemical reactions. It is used in the synthesis of RNA by RNA polymerases.
| Trivial name | / |
| Catalog Number | CSN24877 |
| Alternative Name(s) | / |
| Research Area | / |
| Molecular Formula | C9H14N3Na2O14P3 |
| CAS# | 36051-68-0 |
| Purity | ≥98% |
| SMILES | O=P(OC[C@H]1O[C@@H](N2C=CC(N)=NC2=O)[C@H](O)[C@@H]1O)(OP([O-])(OP(O)([O-])=O)=O)O.[Na+].[Na+] |
| Size | 100mg |
| Supplier Page | https://www.csnpharm.com/products/cytidine-5′-triphosphate-(disodium-salt).html |