Indocyanine green 100mg
Indocyanine green is a cyanine dye used in medical diagnostics. It is used for determining cardiac output, hepatic function, and liver blood flow, and for ophthalmic angiography.
| Trivial name | Indocyanine green 100mg |
| Catalog Number | A10472-100 |
| Alternative Name(s) | Sodium 2-(7-(3,3-dimethyl-1-(4-sulfonatobutyl)benz(e)indolin-2-ylidene)hepta-1,3,5-trien-1-yl)-3,3-dimethyl-1-(4-sulfonatobutyl)benz[e]indolinium |
| Molecular Formula | C43H47N2NaO6S2 |
| CAS# | 3599-32-4 |
| SMILES | CC1(C(=[N+](C2=C1C3=CC=CC=C3C=C2)CCCCS(=O)(=O)[O-])/C=C/C=C/C=C/C=C/4C(C5=C(N4CCCCS(=O)(=O)[O-])C=CC6=CC=CC=C65)(C)C)C.[Na+] |
| Size | 100mg |
| Supplier Page | http://www.adooq.com/indocyanine-green.html |