O-Desethylpiperidine Flavoxate Ethyl Ester
O-Desethylpiperidine Flavoxate Ethyl Ester is an impurity in the synthesis of Flavoxate , a smooth muscle relaxant. Used as antispasmodic; in treatment of urinary incontinence.
| Catalog Number | CS-O-06098 |
| Alternative Name(s) | Flavoxate Hydrochloride Imp. B (EP);Ethyl 3 methyl-4-oxo-2-phenyl-4H-1-benzopyran-8-carboxylate;ethyl 3-methyl-4-oxo-2-phenyl-4H-chromene-8-carboxylate.;Ethyl 3 methyl-4-oxo-2-phenyl-4H-1-benzopyran-8-carboxylate;ethyl 3-methyl-4-oxo-2-phenyl-4H-chromene-8-carboxylate. |
| Research Area | Metabolites |
| Molecular Formula | C19H16O4 |
| CAS# | 35888-94-9 |
| Purity | >98% |
| SMILES | O=C(C1=C(OC(C2=CC=CC=C2)=C(C)C3=O)C3=CC=C1)OCC |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO06098.html |
