(-)-Vestitol
Vestitol is a natural product isolated and purified from the herb of Lotus corniculatus L. with phytoalexin, antimicrobial and anti-inflammatory activities.
| Trivial name | Vestitol |
| Catalog Number | CSN14276 |
| Alternative Name(s) | Vestitol |
| Research Area | / |
| Molecular Formula | C16H16O4 |
| CAS# | 35878-41-2 |
| Purity | ≥98% |
| SMILES | OC1=CC=C2C[C@H](C3=CC=C(OC)C=C3O)COC2=C1 |
| Size | 5mg |
| Supplier Page | https://www.csnpharm.com/products/(-)-vestitol.html |
