Naloxone hydrochloride
Naloxone hydrochloride is a specific opiate antagonist that has no agonist activity. It is a competitive antagonist at mu, delta, and kappa opioid receptors.
| Catalog Number | T0102 |
| Alternative Name(s) | Naloxone HCl |
| Research Area | Endocrinology/Hormones|||Neuroscience|||GPCR/G Protein |
| Molecular Formula | C19H21NO4·HCl |
| CAS# | 357-08-4 |
| Purity | 99.80% |
| SMILES | C=CCN1CC[C@]23[C@@H]4C(=O)CC[C@]2([C@H]1Cc1c3c(c(cc1)O)O4)O.Cl |
| Size | 200 mg |
| Supplier Page | https://www.targetmol.com/compound/Naloxone hydrochloride |
| Additional Information | https://www.targetmol.com/datasheet/T0102 |
