Benzbromarone
API Standard
| Catalog Number | CS-O-11606 |
| Alternative Name(s) | (3,5-Dibromo-4-hydroxyphenyl)(2-ethyl-3-benzofuranyl)methanone |
| Research Area | Benzbromarone is a uricosuric agent used in the treatment of gout and hyperuricemia. Studies show that use of Benzbromarone results in less complications than other uricosuric agent such as Allopurinol. |
| Molecular Formula | C17H12Br2O3 |
| CAS# | 3562-84-3 |
| Purity | >98% |
| SMILES | O=C(C1=CC(Br)=C(O)C(Br)=C1)C(C(C=CC=C2)=C2O3)=C3CC |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO11606.html |