N-Desethyl Sunitinib 50mg
N-desethyl sunitinib is a major and pharmacologically active metabolite of sunitinib, which is potent, ATP-competitive VEGFR, PDGFR?? and KIT inhibitor (Ki values are 2, 9, 17, 8 and 4 nM for VEGFR -1, -2, -3, PDGFR?? and KIT respectively).
| Trivial name | N-Desethyl Sunitinib 50mg |
| Catalog Number | A15182-50 |
| Alternative Name(s) | N-[2-(ethylamino)ethyl]-5-[(Z)-(5-fluoro-2-oxo-1H-indol-3-ylidene)methyl]-2,4-dimethyl-1H-pyrrole-3-carboxamide |
| Molecular Formula | C20H23FN4O2 |
| CAS# | 356068-97-8 |
| SMILES | CCNCCNC(=O)C1=C(NC(=C1C)C=C2C3=C(C=CC(=C3)F)NC2=O)C |
| Size | 50mg |
| Supplier Page | http://www.adooq.com/n-desethyl-sunitinib.html |
