Ki16425 10mM * 1mL in DMSO
Ki16425 is a LPA receptor antagonist with selectivity for LPA1 and LPA3 and exhibits Ki values of 0.34, 6.5, and 0.93 ?M for the human LPA1, LPA2, and LPA3 receptors, respectively.
| Trivial name | Ki16425 10mM * 1mL in DMSO |
| Catalog Number | A10501-10mM-D |
| Alternative Name(s) | 3-?€?[[[4-?€?[4-?€?[[[1-?€?(2-?€?chlorophenyl)ethoxy]carbonyl]amino]-?€?3-?€?methyl-?€?5-?€?isoxazoly]phenyl]methyl]thio]-?€?propanoic acid |
| Molecular Formula | C23H23ClN2O5S |
| CAS# | 355025-24-0 |
| SMILES | CC1=NOC(=C1NC(=O)OC(C)C2=CC=CC=C2Cl)C3=CC=C(C=C3)CSCCC(=O)O |
| Size | 10mM * 1mL in DMSO |
| Supplier Page | http://www.adooq.com/ki16425.html |
