Estradiol hemihydrate
Estradiol Hemihydrate is the hemihydrate form of estradiol, the most potent, naturally produced estrogen. Estradiol hemihydrate diffuses through the cell membrane and binds to and subsequently activates the nuclear estrogen receptor found in the reproductive tract, breast, pituitary, hypothalamus, liver, and bone. The activated complex binds to the estrogen response element on the DNA and activates the transcription of genes involved in the functioning of the female reproductive system and secondary sex characteristics.
Catalog Number | API35380713 |
Alternative Name(s) | beta-Estradiol semihydrate UNII-CXY7B3Q98Z CXY7B3Q98Z |
Research Area | APIs for Estrogens |
Molecular Formula | C36H50O5 |
CAS# | 35380-71-3 |
SMILES | CC12CCC3C(C1CCC2O)CCC4=C3C=CC(=C4)O.CC12CCC3C(C1CCC2O)CCC4=C3C=CC(=C4)O.O |
Size | inquiry |
Supplier Page | https://www.protheragen-ing.com/estradiol-hemihydrate-item-11345.html |